C14H12BrF2NO3S — CID 32773874
N-[(5-bromothiophen-2-yl)methyl]-4-(difluoromethoxy)-3-methoxybenzamide (PubChem CID 32773874) has the molecular formula C14H12BrF2NO3S and a molecular weight of 392.22 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-4-(difluoromethoxy)-3-methoxybenzamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-4-(difluoromethoxy)-3-methoxybenzamide |
|---|---|
| PubChem CID | 32773874 |
| Molecular Formula | C14H12BrF2NO3S |
| Molecular Weight | 392.22 g/mol |
| Exact Mass | 390.97 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-4-(difluoromethoxy)-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)NCc2ccc(Br)s2)ccc1OC(F)F |
| InChI | InChI=1S/C14H12BrF2NO3S/c1-20-11-6-8(2-4-10(11)21-14(16)17)13(19)18-7-9-3-5-12(15)22-9/h2-6,14H,7H2,1H3,(H,18,19) |
| InChIKey | GDJOXBVDNLTNNN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.22 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |