C13H14N2O3S — CID 91460435
N-[(2,3-dimethoxyphenyl)methyl]-1,3-thiazole-4-carboxamide (PubChem CID 91460435) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is N-[(2,3-dimethoxyphenyl)methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(2,3-dimethoxyphenyl)methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 91460435 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | N-[(2,3-dimethoxyphenyl)methyl]-1,3-thiazole-4-carboxamide |
| SMILES | COc1cccc(CNC(=O)c2cscn2)c1OC |
| InChI | InChI=1S/C13H14N2O3S/c1-17-11-5-3-4-9(12(11)18-2)6-14-13(16)10-7-19-8-15-10/h3-5,7-8H,6H2,1-2H3,(H,14,16) |
| InChIKey | SGGDSGJPTLLGIR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |