C19H19N3O3S — CID 50830665
2-anilino-N-[(2,3-dimethoxyphenyl)methyl]-1,3-thiazole-4-carboxamide (PubChem CID 50830665) has the molecular formula C19H19N3O3S and a molecular weight of 369.45 g/mol. Its IUPAC name is 2-anilino-N-[(2,3-dimethoxyphenyl)methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-anilino-N-[(2,3-dimethoxyphenyl)methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 50830665 |
| Molecular Formula | C19H19N3O3S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 2-anilino-N-[(2,3-dimethoxyphenyl)methyl]-1,3-thiazole-4-carboxamide |
| SMILES | COc1cccc(CNC(=O)c2csc(Nc3ccccc3)n2)c1OC |
| InChI | InChI=1S/C19H19N3O3S/c1-24-16-10-6-7-13(17(16)25-2)11-20-18(23)15-12-26-19(22-15)21-14-8-4-3-5-9-14/h3-10,12H,11H2,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | DKYNTYQVYBJXAF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |