C12H11N3O3S — CID 42813690
2-[(2-anilino-1,3-thiazole-4-carbonyl)amino]acetic acid (PubChem CID 42813690) has the molecular formula C12H11N3O3S and a molecular weight of 277.31 g/mol. Its IUPAC name is 2-[(2-anilino-1,3-thiazole-4-carbonyl)amino]acetic acid.
| Compound Name | 2-[(2-anilino-1,3-thiazole-4-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 42813690 |
| Molecular Formula | C12H11N3O3S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 2-[(2-anilino-1,3-thiazole-4-carbonyl)amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1csc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C12H11N3O3S/c16-10(17)6-13-11(18)9-7-19-12(15-9)14-8-4-2-1-3-5-8/h1-5,7H,6H2,(H,13,18)(H,14,15)(H,16,17) |
| InChIKey | PEYGZQQUOKAHJP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |