C14H14N4O4S — CID 18322900
2-[[2-(benzylcarbamoylamino)-1,3-thiazole-4-carbonyl]amino]acetic acid (PubChem CID 18322900) has the molecular formula C14H14N4O4S and a molecular weight of 334.36 g/mol. Its IUPAC name is 2-[[2-(benzylcarbamoylamino)-1,3-thiazole-4-carbonyl]amino]acetic acid.
| Compound Name | 2-[[2-(benzylcarbamoylamino)-1,3-thiazole-4-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 18322900 |
| Molecular Formula | C14H14N4O4S |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 2-[[2-(benzylcarbamoylamino)-1,3-thiazole-4-carbonyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1csc(NC(=O)NCc2ccccc2)n1 |
| InChI | InChI=1S/C14H14N4O4S/c19-11(20)7-15-12(21)10-8-23-14(17-10)18-13(22)16-6-9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H,15,21)(H,19,20)(H2,16,17,18,22) |
| InChIKey | AHYQGKFPUGXUNU-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |