C23H23N5O5S — CID 174390395
(propanoylamino) 2-[2-[[2-(benzylcarbamoylamino)-1,3-thiazole-4-carbonyl]amino]phenyl]acetate (PubChem CID 174390395) has the molecular formula C23H23N5O5S and a molecular weight of 481.53 g/mol. Its IUPAC name is (propanoylamino) 2-[2-[[2-(benzylcarbamoylamino)-1,3-thiazole-4-carbonyl]amino]phenyl]acetate.
| Compound Name | (propanoylamino) 2-[2-[[2-(benzylcarbamoylamino)-1,3-thiazole-4-carbonyl]amino]phenyl]acetate |
|---|---|
| PubChem CID | 174390395 |
| Molecular Formula | C23H23N5O5S |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | (propanoylamino) 2-[2-[[2-(benzylcarbamoylamino)-1,3-thiazole-4-carbonyl]amino]phenyl]acetate |
| SMILES | CCC(=O)NOC(=O)Cc1ccccc1NC(=O)c1csc(NC(=O)NCc2ccccc2)n1 |
| InChI | InChI=1S/C23H23N5O5S/c1-2-19(29)28-33-20(30)12-16-10-6-7-11-17(16)25-21(31)18-14-34-23(26-18)27-22(32)24-13-15-8-4-3-5-9-15/h3-11,14H,2,12-13H2,1H3,(H,25,31)(H,28,29)(H2,24,26,27,32) |
| InChIKey | PYISSYDPFUIXHO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 138.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|