C18H15N3O2S — CID 16914921
2-benzamido-N-benzyl-1,3-thiazole-4-carboxamide (PubChem CID 16914921) has the molecular formula C18H15N3O2S and a molecular weight of 337.40 g/mol. Its IUPAC name is 2-benzamido-N-benzyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-benzamido-N-benzyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 16914921 |
| Molecular Formula | C18H15N3O2S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 2-benzamido-N-benzyl-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1nc(C(=O)NCc2ccccc2)cs1)c1ccccc1 |
| InChI | InChI=1S/C18H15N3O2S/c22-16(14-9-5-2-6-10-14)21-18-20-15(12-24-18)17(23)19-11-13-7-3-1-4-8-13/h1-10,12H,11H2,(H,19,23)(H,20,21,22) |
| InChIKey | PUAMNQYOKZWIKH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |