C17H16N4OS — CID 117089108
N-benzyl-2-(pyridin-3-ylmethylamino)-1,3-thiazole-4-carboxamide (PubChem CID 117089108) has the molecular formula C17H16N4OS and a molecular weight of 324.41 g/mol. Its IUPAC name is N-benzyl-2-(pyridin-3-ylmethylamino)-1,3-thiazole-4-carboxamide.
| Compound Name | N-benzyl-2-(pyridin-3-ylmethylamino)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 117089108 |
| Molecular Formula | C17H16N4OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | N-benzyl-2-(pyridin-3-ylmethylamino)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1csc(NCc2cccnc2)n1 |
| InChI | InChI=1S/C17H16N4OS/c22-16(19-10-13-5-2-1-3-6-13)15-12-23-17(21-15)20-11-14-7-4-8-18-9-14/h1-9,12H,10-11H2,(H,19,22)(H,20,21) |
| InChIKey | IQCSEIVVHMZDMS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |