C26H28N5O5S- — CID 18323121
3-(benzylcarbamoyl)-6-[[2-(benzylcarbamoylamino)-1,3-thiazole-4-carbonyl]amino]hexanoate (PubChem CID 18323121) has the molecular formula C26H28N5O5S- and a molecular weight of 522.61 g/mol. Its IUPAC name is 3-(benzylcarbamoyl)-6-[[2-(benzylcarbamoylamino)-1,3-thiazole-4-carbonyl]amino]hexanoate.
| Compound Name | 3-(benzylcarbamoyl)-6-[[2-(benzylcarbamoylamino)-1,3-thiazole-4-carbonyl]amino]hexanoate |
|---|---|
| PubChem CID | 18323121 |
| Molecular Formula | C26H28N5O5S- |
| Molecular Weight | 522.61 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | 3-(benzylcarbamoyl)-6-[[2-(benzylcarbamoylamino)-1,3-thiazole-4-carbonyl]amino]hexanoate |
| SMILES | O=C([O-])CC(CCCNC(=O)c1csc(NC(=O)NCc2ccccc2)n1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C26H29N5O5S/c32-22(33)14-20(23(34)28-15-18-8-3-1-4-9-18)12-7-13-27-24(35)21-17-37-26(30-21)31-25(36)29-16-19-10-5-2-6-11-19/h1-6,8-11,17,20H,7,12-16H2,(H,27,35)(H,28,34)(H,32,33)(H2,29,30,31,36)/p-1 |
| InChIKey | NJENIZRAKPLSLH-UHFFFAOYSA-M |
| XLogP | 2.05 |
| TPSA | 152.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.61 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|