C18H15ClN4O2S — CID 42813501
N-(2-anilino-2-oxoethyl)-2-(2-chloroanilino)-1,3-thiazole-4-carboxamide (PubChem CID 42813501) has the molecular formula C18H15ClN4O2S and a molecular weight of 386.86 g/mol. Its IUPAC name is N-(2-anilino-2-oxoethyl)-2-(2-chloroanilino)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2-anilino-2-oxoethyl)-2-(2-chloroanilino)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 42813501 |
| Molecular Formula | C18H15ClN4O2S |
| Molecular Weight | 386.86 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | N-(2-anilino-2-oxoethyl)-2-(2-chloroanilino)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(CNC(=O)c1csc(Nc2ccccc2Cl)n1)Nc1ccccc1 |
| InChI | InChI=1S/C18H15ClN4O2S/c19-13-8-4-5-9-14(13)22-18-23-15(11-26-18)17(25)20-10-16(24)21-12-6-2-1-3-7-12/h1-9,11H,10H2,(H,20,25)(H,21,24)(H,22,23) |
| InChIKey | ZPZXUKVDOPJOKJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.86 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |