C13H11BrF2N2O2 — CID 30462324
4-bromo-N-[[2-(difluoromethoxy)phenyl]methyl]-1H-pyrrole-2-carboxamide (PubChem CID 30462324) has the molecular formula C13H11BrF2N2O2 and a molecular weight of 345.14 g/mol. Its IUPAC name is 4-bromo-N-[[2-(difluoromethoxy)phenyl]methyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[[2-(difluoromethoxy)phenyl]methyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 30462324 |
| Molecular Formula | C13H11BrF2N2O2 |
| Molecular Weight | 345.14 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | 4-bromo-N-[[2-(difluoromethoxy)phenyl]methyl]-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NCc1ccccc1OC(F)F)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C13H11BrF2N2O2/c14-9-5-10(17-7-9)12(19)18-6-8-3-1-2-4-11(8)20-13(15)16/h1-5,7,13,17H,6H2,(H,18,19) |
| InChIKey | HDZFDFYCLTWSOI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.14 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |