C14H13BrN2O3 — CID 81318040
2-[2-[[(4-bromo-1H-pyrrole-2-carbonyl)amino]methyl]phenyl]acetic acid (PubChem CID 81318040) has the molecular formula C14H13BrN2O3 and a molecular weight of 337.17 g/mol. Its IUPAC name is 2-[2-[[(4-bromo-1H-pyrrole-2-carbonyl)amino]methyl]phenyl]acetic acid.
| Compound Name | 2-[2-[[(4-bromo-1H-pyrrole-2-carbonyl)amino]methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 81318040 |
| Molecular Formula | C14H13BrN2O3 |
| Molecular Weight | 337.17 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | 2-[2-[[(4-bromo-1H-pyrrole-2-carbonyl)amino]methyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccccc1CNC(=O)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C14H13BrN2O3/c15-11-6-12(16-8-11)14(20)17-7-10-4-2-1-3-9(10)5-13(18)19/h1-4,6,8,16H,5,7H2,(H,17,20)(H,18,19) |
| InChIKey | HUEIXOZXRNVUCE-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.17 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |