C10H10BrN3O — CID 106385056
4-bromo-N-(1H-pyrrol-3-ylmethyl)-1H-pyrrole-2-carboxamide (PubChem CID 106385056) has the molecular formula C10H10BrN3O and a molecular weight of 268.11 g/mol. Its IUPAC name is 4-bromo-N-(1H-pyrrol-3-ylmethyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-(1H-pyrrol-3-ylmethyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 106385056 |
| Molecular Formula | C10H10BrN3O |
| Molecular Weight | 268.11 g/mol |
| Exact Mass | 267.00 |
| IUPAC Name | 4-bromo-N-(1H-pyrrol-3-ylmethyl)-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NCc1cc[nH]c1)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C10H10BrN3O/c11-8-3-9(13-6-8)10(15)14-5-7-1-2-12-4-7/h1-4,6,12-13H,5H2,(H,14,15) |
| InChIKey | CTNLEIZHHIVMLC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.11 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |