C15H17BrN2O — CID 43410595
4-bromo-N-(2,6-diethylphenyl)-1H-pyrrole-2-carboxamide (PubChem CID 43410595) has the molecular formula C15H17BrN2O and a molecular weight of 321.22 g/mol. Its IUPAC name is 4-bromo-N-(2,6-diethylphenyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-(2,6-diethylphenyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43410595 |
| Molecular Formula | C15H17BrN2O |
| Molecular Weight | 321.22 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 4-bromo-N-(2,6-diethylphenyl)-1H-pyrrole-2-carboxamide |
| SMILES | CCc1cccc(CC)c1NC(=O)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C15H17BrN2O/c1-3-10-6-5-7-11(4-2)14(10)18-15(19)13-8-12(16)9-17-13/h5-9,17H,3-4H2,1-2H3,(H,18,19) |
| InChIKey | QHPCREFDQGBPQE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.22 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |