C16H17BrN4O3 — CID 33472385
N-[3-[2-(4-bromo-1H-pyrrole-2-carbonyl)hydrazinyl]-3-oxopropyl]-2-phenylacetamide (PubChem CID 33472385) has the molecular formula C16H17BrN4O3 and a molecular weight of 393.24 g/mol. Its IUPAC name is N-[3-[2-(4-bromo-1H-pyrrole-2-carbonyl)hydrazinyl]-3-oxopropyl]-2-phenylacetamide.
| Compound Name | N-[3-[2-(4-bromo-1H-pyrrole-2-carbonyl)hydrazinyl]-3-oxopropyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 33472385 |
| Molecular Formula | C16H17BrN4O3 |
| Molecular Weight | 393.24 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | N-[3-[2-(4-bromo-1H-pyrrole-2-carbonyl)hydrazinyl]-3-oxopropyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NCCC(=O)NNC(=O)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C16H17BrN4O3/c17-12-9-13(19-10-12)16(24)21-20-14(22)6-7-18-15(23)8-11-4-2-1-3-5-11/h1-5,9-10,19H,6-8H2,(H,18,23)(H,20,22)(H,21,24) |
| InChIKey | FTKKRXWHABQZNI-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.24 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|