C15H15Br2N3O3 — CID 31598036
4-bromo-N'-[4-(3-bromophenoxy)butanoyl]-1H-pyrrole-2-carbohydrazide (PubChem CID 31598036) has the molecular formula C15H15Br2N3O3 and a molecular weight of 445.11 g/mol. Its IUPAC name is 4-bromo-N'-[4-(3-bromophenoxy)butanoyl]-1H-pyrrole-2-carbohydrazide.
| Compound Name | 4-bromo-N'-[4-(3-bromophenoxy)butanoyl]-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 31598036 |
| Molecular Formula | C15H15Br2N3O3 |
| Molecular Weight | 445.11 g/mol |
| Exact Mass | 442.95 |
| IUPAC Name | 4-bromo-N'-[4-(3-bromophenoxy)butanoyl]-1H-pyrrole-2-carbohydrazide |
| SMILES | O=C(CCCOc1cccc(Br)c1)NNC(=O)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C15H15Br2N3O3/c16-10-3-1-4-12(7-10)23-6-2-5-14(21)19-20-15(22)13-8-11(17)9-18-13/h1,3-4,7-9,18H,2,5-6H2,(H,19,21)(H,20,22) |
| InChIKey | PQGHIPDVWBDVFY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.11 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|