C19H24BrN3O3 — CID 31421381
4-bromo-N'-[4-(4-tert-butylphenoxy)butanoyl]-1H-pyrrole-2-carbohydrazide (PubChem CID 31421381) has the molecular formula C19H24BrN3O3 and a molecular weight of 422.32 g/mol. Its IUPAC name is 4-bromo-N'-[4-(4-tert-butylphenoxy)butanoyl]-1H-pyrrole-2-carbohydrazide.
| Compound Name | 4-bromo-N'-[4-(4-tert-butylphenoxy)butanoyl]-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 31421381 |
| Molecular Formula | C19H24BrN3O3 |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 4-bromo-N'-[4-(4-tert-butylphenoxy)butanoyl]-1H-pyrrole-2-carbohydrazide |
| SMILES | CC(C)(C)c1ccc(OCCCC(=O)NNC(=O)c2cc(Br)c[nH]2)cc1 |
| InChI | InChI=1S/C19H24BrN3O3/c1-19(2,3)13-6-8-15(9-7-13)26-10-4-5-17(24)22-23-18(25)16-11-14(20)12-21-16/h6-9,11-12,21H,4-5,10H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | SZYGOERBASKZGQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|