C10H14BrN3O2 — CID 18121265
4-bromo-N'-(3-methylbutanoyl)-1H-pyrrole-2-carbohydrazide (PubChem CID 18121265) has the molecular formula C10H14BrN3O2 and a molecular weight of 288.14 g/mol. Its IUPAC name is 4-bromo-N'-(3-methylbutanoyl)-1H-pyrrole-2-carbohydrazide.
| Compound Name | 4-bromo-N'-(3-methylbutanoyl)-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 18121265 |
| Molecular Formula | C10H14BrN3O2 |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 4-bromo-N'-(3-methylbutanoyl)-1H-pyrrole-2-carbohydrazide |
| SMILES | CC(C)CC(=O)NNC(=O)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C10H14BrN3O2/c1-6(2)3-9(15)13-14-10(16)8-4-7(11)5-12-8/h4-6,12H,3H2,1-2H3,(H,13,15)(H,14,16) |
| InChIKey | RPCNXGMCFAVJEQ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|