C6H7BrN2O2 — CID 103608505
4-bromo-N-methoxy-1H-pyrrole-2-carboxamide (PubChem CID 103608505) has the molecular formula C6H7BrN2O2 and a molecular weight of 219.04 g/mol. Its IUPAC name is 4-bromo-N-methoxy-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-methoxy-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 103608505 |
| Molecular Formula | C6H7BrN2O2 |
| Molecular Weight | 219.04 g/mol |
| Exact Mass | 217.97 |
| IUPAC Name | 4-bromo-N-methoxy-1H-pyrrole-2-carboxamide |
| SMILES | CONC(=O)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C6H7BrN2O2/c1-11-9-6(10)5-2-4(7)3-8-5/h2-3,8H,1H3,(H,9,10) |
| InChIKey | IMWLFBXELNDYRZ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.04 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|