C10H13BrN2O4 — CID 62480168
2-[(4-bromo-1H-pyrrole-2-carbonyl)amino]-4-methoxybutanoic acid (PubChem CID 62480168) has the molecular formula C10H13BrN2O4 and a molecular weight of 305.13 g/mol. Its IUPAC name is 2-[(4-bromo-1H-pyrrole-2-carbonyl)amino]-4-methoxybutanoic acid.
| Compound Name | 2-[(4-bromo-1H-pyrrole-2-carbonyl)amino]-4-methoxybutanoic acid |
|---|---|
| PubChem CID | 62480168 |
| Molecular Formula | C10H13BrN2O4 |
| Molecular Weight | 305.13 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 2-[(4-bromo-1H-pyrrole-2-carbonyl)amino]-4-methoxybutanoic acid |
| SMILES | COCCC(NC(=O)c1cc(Br)c[nH]1)C(=O)O |
| InChI | InChI=1S/C10H13BrN2O4/c1-17-3-2-7(10(15)16)13-9(14)8-4-6(11)5-12-8/h4-5,7,12H,2-3H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | ZFBDYOBMNORHIG-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.13 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |