C17H21BrN2O4 — CID 55748639
4-bromo-N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]-1H-pyrrole-2-carboxamide (PubChem CID 55748639) has the molecular formula C17H21BrN2O4 and a molecular weight of 397.27 g/mol. Its IUPAC name is 4-bromo-N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 55748639 |
| Molecular Formula | C17H21BrN2O4 |
| Molecular Weight | 397.27 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 4-bromo-N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]-1H-pyrrole-2-carboxamide |
| SMILES | COCCOc1ccc(C(C)NC(=O)c2cc(Br)c[nH]2)cc1OC |
| InChI | InChI=1S/C17H21BrN2O4/c1-11(20-17(21)14-9-13(18)10-19-14)12-4-5-15(16(8-12)23-3)24-7-6-22-2/h4-5,8-11,19H,6-7H2,1-3H3,(H,20,21) |
| InChIKey | SYWHVTMEGURFOI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.27 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|