C20H20BrN3O3 — CID 55932540
4-bromo-N-[1-[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]ethyl]-1H-pyrrole-2-carboxamide (PubChem CID 55932540) has the molecular formula C20H20BrN3O3 and a molecular weight of 430.30 g/mol. Its IUPAC name is 4-bromo-N-[1-[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]ethyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[1-[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]ethyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 55932540 |
| Molecular Formula | C20H20BrN3O3 |
| Molecular Weight | 430.30 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | 4-bromo-N-[1-[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]ethyl]-1H-pyrrole-2-carboxamide |
| SMILES | COc1cc(C(C)NC(=O)c2cc(Br)c[nH]2)ccc1OCc1ccncc1 |
| InChI | InChI=1S/C20H20BrN3O3/c1-13(24-20(25)17-10-16(21)11-23-17)15-3-4-18(19(9-15)26-2)27-12-14-5-7-22-8-6-14/h3-11,13,23H,12H2,1-2H3,(H,24,25) |
| InChIKey | XEPPBIUVNGUGJM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.30 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |