C25H24N2O4 — CID 55807945
N-[1-[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]ethyl]-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 55807945) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is N-[1-[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]ethyl]-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | N-[1-[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]ethyl]-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 55807945 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | N-[1-[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]ethyl]-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | COc1cc(C(C)NC(=O)c2oc3ccccc3c2C)ccc1OCc1ccncc1 |
| InChI | InChI=1S/C25H24N2O4/c1-16-20-6-4-5-7-21(20)31-24(16)25(28)27-17(2)19-8-9-22(23(14-19)29-3)30-15-18-10-12-26-13-11-18/h4-14,17H,15H2,1-3H3,(H,27,28) |
| InChIKey | YAAWPURMPDKWND-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |