C20H19BrN4O4 — CID 39641079
4-bromo-N'-[3-ethoxy-4-(pyridin-4-ylmethoxy)benzoyl]-1H-pyrrole-2-carbohydrazide (PubChem CID 39641079) has the molecular formula C20H19BrN4O4 and a molecular weight of 459.30 g/mol. Its IUPAC name is 4-bromo-N'-[3-ethoxy-4-(pyridin-4-ylmethoxy)benzoyl]-1H-pyrrole-2-carbohydrazide.
| Compound Name | 4-bromo-N'-[3-ethoxy-4-(pyridin-4-ylmethoxy)benzoyl]-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 39641079 |
| Molecular Formula | C20H19BrN4O4 |
| Molecular Weight | 459.30 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | 4-bromo-N'-[3-ethoxy-4-(pyridin-4-ylmethoxy)benzoyl]-1H-pyrrole-2-carbohydrazide |
| SMILES | CCOc1cc(C(=O)NNC(=O)c2cc(Br)c[nH]2)ccc1OCc1ccncc1 |
| InChI | InChI=1S/C20H19BrN4O4/c1-2-28-18-9-14(3-4-17(18)29-12-13-5-7-22-8-6-13)19(26)24-25-20(27)16-10-15(21)11-23-16/h3-11,23H,2,12H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | FXLPQJNCFFVWFI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 105.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|