C19H21BrClNO4 — CID 78890426
2-bromo-5-chloro-N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]benzamide (PubChem CID 78890426) has the molecular formula C19H21BrClNO4 and a molecular weight of 442.74 g/mol. Its IUPAC name is 2-bromo-5-chloro-N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]benzamide.
| Compound Name | 2-bromo-5-chloro-N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 78890426 |
| Molecular Formula | C19H21BrClNO4 |
| Molecular Weight | 442.74 g/mol |
| Exact Mass | 441.03 |
| IUPAC Name | 2-bromo-5-chloro-N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]benzamide |
| SMILES | COCCOc1ccc(C(C)NC(=O)c2cc(Cl)ccc2Br)cc1OC |
| InChI | InChI=1S/C19H21BrClNO4/c1-12(22-19(23)15-11-14(21)5-6-16(15)20)13-4-7-17(18(10-13)25-3)26-9-8-24-2/h4-7,10-12H,8-9H2,1-3H3,(H,22,23) |
| InChIKey | GCXWVWHFKMLCKZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.74 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|