C21H28N2O4 — CID 8533676
4-acetyl-N-[(1S)-1-(3,4-dipropoxyphenyl)ethyl]-1H-pyrrole-2-carboxamide (PubChem CID 8533676) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is 4-acetyl-N-[(1S)-1-(3,4-dipropoxyphenyl)ethyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-acetyl-N-[(1S)-1-(3,4-dipropoxyphenyl)ethyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 8533676 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 4-acetyl-N-[(1S)-1-(3,4-dipropoxyphenyl)ethyl]-1H-pyrrole-2-carboxamide |
| SMILES | CCCOc1ccc([C@H](C)NC(=O)c2cc(C(C)=O)c[nH]2)cc1OCCC |
| InChI | InChI=1S/C21H28N2O4/c1-5-9-26-19-8-7-16(12-20(19)27-10-6-2)14(3)23-21(25)18-11-17(13-22-18)15(4)24/h7-8,11-14,22H,5-6,9-10H2,1-4H3,(H,23,25)/t14-/m0/s1 |
| InChIKey | WUOGOLUBFGYEAP-AWEZNQCLSA-N |
| XLogP | 4.29 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |