C21H27N3O5 — CID 43017364
4-amino-N-[1-(3,4-dipropoxyphenyl)ethyl]-3-nitrobenzamide (PubChem CID 43017364) has the molecular formula C21H27N3O5 and a molecular weight of 401.46 g/mol. Its IUPAC name is 4-amino-N-[1-(3,4-dipropoxyphenyl)ethyl]-3-nitrobenzamide.
| Compound Name | 4-amino-N-[1-(3,4-dipropoxyphenyl)ethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 43017364 |
| Molecular Formula | C21H27N3O5 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 4-amino-N-[1-(3,4-dipropoxyphenyl)ethyl]-3-nitrobenzamide |
| SMILES | CCCOc1ccc(C(C)NC(=O)c2ccc(N)c([N+](=O)[O-])c2)cc1OCCC |
| InChI | InChI=1S/C21H27N3O5/c1-4-10-28-19-9-7-15(13-20(19)29-11-5-2)14(3)23-21(25)16-6-8-17(22)18(12-16)24(26)27/h6-9,12-14H,4-5,10-11,22H2,1-3H3,(H,23,25) |
| InChIKey | KKGOXEMYZVHLAT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|