C20H26N2O5S — CID 26011119
3-ethoxy-4-propoxy-N-[(1R)-1-(3-sulfamoylphenyl)ethyl]benzamide (PubChem CID 26011119) has the molecular formula C20H26N2O5S and a molecular weight of 406.50 g/mol. Its IUPAC name is 3-ethoxy-4-propoxy-N-[(1R)-1-(3-sulfamoylphenyl)ethyl]benzamide.
| Compound Name | 3-ethoxy-4-propoxy-N-[(1R)-1-(3-sulfamoylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 26011119 |
| Molecular Formula | C20H26N2O5S |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 3-ethoxy-4-propoxy-N-[(1R)-1-(3-sulfamoylphenyl)ethyl]benzamide |
| SMILES | CCCOc1ccc(C(=O)N[C@H](C)c2cccc(S(N)(=O)=O)c2)cc1OCC |
| InChI | InChI=1S/C20H26N2O5S/c1-4-11-27-18-10-9-16(13-19(18)26-5-2)20(23)22-14(3)15-7-6-8-17(12-15)28(21,24)25/h6-10,12-14H,4-5,11H2,1-3H3,(H,22,23)(H2,21,24,25)/t14-/m1/s1 |
| InChIKey | WBBRGVUAKGNRJS-CQSZACIVSA-N |
| XLogP | 3.01 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |