C21H26N2O5S — CID 55396046
4-oxo-4-(4-propoxyphenyl)-N-[1-(3-sulfamoylphenyl)ethyl]butanamide (PubChem CID 55396046) has the molecular formula C21H26N2O5S and a molecular weight of 418.52 g/mol. Its IUPAC name is 4-oxo-4-(4-propoxyphenyl)-N-[1-(3-sulfamoylphenyl)ethyl]butanamide.
| Compound Name | 4-oxo-4-(4-propoxyphenyl)-N-[1-(3-sulfamoylphenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 55396046 |
| Molecular Formula | C21H26N2O5S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 4-oxo-4-(4-propoxyphenyl)-N-[1-(3-sulfamoylphenyl)ethyl]butanamide |
| SMILES | CCCOc1ccc(C(=O)CCC(=O)NC(C)c2cccc(S(N)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C21H26N2O5S/c1-3-13-28-18-9-7-16(8-10-18)20(24)11-12-21(25)23-15(2)17-5-4-6-19(14-17)29(22,26)27/h4-10,14-15H,3,11-13H2,1-2H3,(H,23,25)(H2,22,26,27) |
| InChIKey | GJKAWOCXMAKHQN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |