C18H25NO5 — CID 119348424
3-methyl-2-[[4-oxo-4-(4-propoxyphenyl)butanoyl]amino]butanoic acid (PubChem CID 119348424) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is 3-methyl-2-[[4-oxo-4-(4-propoxyphenyl)butanoyl]amino]butanoic acid.
| Compound Name | 3-methyl-2-[[4-oxo-4-(4-propoxyphenyl)butanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119348424 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 3-methyl-2-[[4-oxo-4-(4-propoxyphenyl)butanoyl]amino]butanoic acid |
| SMILES | CCCOc1ccc(C(=O)CCC(=O)NC(C(=O)O)C(C)C)cc1 |
| InChI | InChI=1S/C18H25NO5/c1-4-11-24-14-7-5-13(6-8-14)15(20)9-10-16(21)19-17(12(2)3)18(22)23/h5-8,12,17H,4,9-11H2,1-3H3,(H,19,21)(H,22,23) |
| InChIKey | DNSFSJAMUFCBBQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |