C22H33NO6 — CID 7832306
(2R,3R)-2-[[4-(3,4-dipropoxyphenyl)-4-oxobutanoyl]amino]-3-methylpentanoic acid (PubChem CID 7832306) has the molecular formula C22H33NO6 and a molecular weight of 407.51 g/mol. Its IUPAC name is (2R,3R)-2-[[4-(3,4-dipropoxyphenyl)-4-oxobutanoyl]amino]-3-methylpentanoic acid.
| Compound Name | (2R,3R)-2-[[4-(3,4-dipropoxyphenyl)-4-oxobutanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 7832306 |
| Molecular Formula | C22H33NO6 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | (2R,3R)-2-[[4-(3,4-dipropoxyphenyl)-4-oxobutanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCCOc1ccc(C(=O)CCC(=O)N[C@@H](C(=O)O)[C@H](C)CC)cc1OCCC |
| InChI | InChI=1S/C22H33NO6/c1-5-12-28-18-10-8-16(14-19(18)29-13-6-2)17(24)9-11-20(25)23-21(22(26)27)15(4)7-3/h8,10,14-15,21H,5-7,9,11-13H2,1-4H3,(H,23,25)(H,26,27)/t15-,21-/m1/s1 |
| InChIKey | XRDXWHQDXHGMIS-QVKFZJNVSA-N |
| XLogP | 3.84 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |