C16H25NO3 — CID 81462222
3-amino-1-(3,4-dipropoxyphenyl)butan-1-one (PubChem CID 81462222) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is 3-amino-1-(3,4-dipropoxyphenyl)butan-1-one.
| Compound Name | 3-amino-1-(3,4-dipropoxyphenyl)butan-1-one |
|---|---|
| PubChem CID | 81462222 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 3-amino-1-(3,4-dipropoxyphenyl)butan-1-one |
| SMILES | CCCOc1ccc(C(=O)CC(C)N)cc1OCCC |
| InChI | InChI=1S/C16H25NO3/c1-4-8-19-15-7-6-13(14(18)10-12(3)17)11-16(15)20-9-5-2/h6-7,11-12H,4-5,8-10,17H2,1-3H3 |
| InChIKey | UWOJGEQKAFCIPL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |