C16H23BrO3 — CID 63385990
2-bromo-1-(3,4-dipropoxyphenyl)butan-1-one (PubChem CID 63385990) has the molecular formula C16H23BrO3 and a molecular weight of 343.26 g/mol. Its IUPAC name is 2-bromo-1-(3,4-dipropoxyphenyl)butan-1-one.
| Compound Name | 2-bromo-1-(3,4-dipropoxyphenyl)butan-1-one |
|---|---|
| PubChem CID | 63385990 |
| Molecular Formula | C16H23BrO3 |
| Molecular Weight | 343.26 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 2-bromo-1-(3,4-dipropoxyphenyl)butan-1-one |
| SMILES | CCCOc1ccc(C(=O)C(Br)CC)cc1OCCC |
| InChI | InChI=1S/C16H23BrO3/c1-4-9-19-14-8-7-12(16(18)13(17)6-3)11-15(14)20-10-5-2/h7-8,11,13H,4-6,9-10H2,1-3H3 |
| InChIKey | BQKWFZDDPDUDMT-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.26 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|