C13H17BrO3 — CID 11514957
2-bromo-1-(3,4-dimethoxyphenyl)pentan-1-one (PubChem CID 11514957) has the molecular formula C13H17BrO3 and a molecular weight of 301.18 g/mol. Its IUPAC name is 2-bromo-1-(3,4-dimethoxyphenyl)pentan-1-one.
| Compound Name | 2-bromo-1-(3,4-dimethoxyphenyl)pentan-1-one |
|---|---|
| PubChem CID | 11514957 |
| Molecular Formula | C13H17BrO3 |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 2-bromo-1-(3,4-dimethoxyphenyl)pentan-1-one |
| SMILES | CCCC(Br)C(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C13H17BrO3/c1-4-5-10(14)13(15)9-6-7-11(16-2)12(8-9)17-3/h6-8,10H,4-5H2,1-3H3 |
| InChIKey | YNKKYOKUJBFUTP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|