C11H13BrO4 — CID 19388505
2-bromo-1-(3,4-dimethoxyphenyl)-2-methoxyethanone (PubChem CID 19388505) has the molecular formula C11H13BrO4 and a molecular weight of 289.13 g/mol. Its IUPAC name is 2-bromo-1-(3,4-dimethoxyphenyl)-2-methoxyethanone.
| Compound Name | 2-bromo-1-(3,4-dimethoxyphenyl)-2-methoxyethanone |
|---|---|
| PubChem CID | 19388505 |
| Molecular Formula | C11H13BrO4 |
| Molecular Weight | 289.13 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | 2-bromo-1-(3,4-dimethoxyphenyl)-2-methoxyethanone |
| SMILES | COc1ccc(C(=O)C(Br)OC)cc1OC |
| InChI | InChI=1S/C11H13BrO4/c1-14-8-5-4-7(6-9(8)15-2)10(13)11(12)16-3/h4-6,11H,1-3H3 |
| InChIKey | QSAOBBKGNRRRBK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.13 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|