C15H14BrNO3 — CID 99647138
(2S)-2-bromo-1-(3,4-dimethoxyphenyl)-2-pyridin-4-ylethanone (PubChem CID 99647138) has the molecular formula C15H14BrNO3 and a molecular weight of 336.19 g/mol. Its IUPAC name is (2S)-2-bromo-1-(3,4-dimethoxyphenyl)-2-pyridin-4-ylethanone.
| Compound Name | (2S)-2-bromo-1-(3,4-dimethoxyphenyl)-2-pyridin-4-ylethanone |
|---|---|
| PubChem CID | 99647138 |
| Molecular Formula | C15H14BrNO3 |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | (2S)-2-bromo-1-(3,4-dimethoxyphenyl)-2-pyridin-4-ylethanone |
| SMILES | COc1ccc(C(=O)[C@@H](Br)c2ccncc2)cc1OC |
| InChI | InChI=1S/C15H14BrNO3/c1-19-12-4-3-11(9-13(12)20-2)15(18)14(16)10-5-7-17-8-6-10/h3-9,14H,1-2H3/t14-/m0/s1 |
| InChIKey | AIKSMJLTVMUCAS-AWEZNQCLSA-N |
| XLogP | 3.42 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|