C18H18Br2O4 — CID 3903581
2,3-dibromo-1-(3,4-dimethoxyphenyl)-3-(4-methoxyphenyl)propan-1-one (PubChem CID 3903581) has the molecular formula C18H18Br2O4 and a molecular weight of 458.15 g/mol. Its IUPAC name is 2,3-dibromo-1-(3,4-dimethoxyphenyl)-3-(4-methoxyphenyl)propan-1-one.
| Compound Name | 2,3-dibromo-1-(3,4-dimethoxyphenyl)-3-(4-methoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 3903581 |
| Molecular Formula | C18H18Br2O4 |
| Molecular Weight | 458.15 g/mol |
| Exact Mass | 455.96 |
| IUPAC Name | 2,3-dibromo-1-(3,4-dimethoxyphenyl)-3-(4-methoxyphenyl)propan-1-one |
| SMILES | COc1ccc(C(Br)C(Br)C(=O)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C18H18Br2O4/c1-22-13-7-4-11(5-8-13)16(19)17(20)18(21)12-6-9-14(23-2)15(10-12)24-3/h4-10,16-17H,1-3H3 |
| InChIKey | RAMYPUBFSIHMBK-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.15 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|