C18H18O5 — CID 19421512
(Z)-3-(3,4-dimethoxyphenyl)-3-(4-methoxyphenyl)prop-2-enoic acid (PubChem CID 19421512) has the molecular formula C18H18O5 and a molecular weight of 314.34 g/mol. Its IUPAC name is (Z)-3-(3,4-dimethoxyphenyl)-3-(4-methoxyphenyl)prop-2-enoic acid.
| Compound Name | (Z)-3-(3,4-dimethoxyphenyl)-3-(4-methoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 19421512 |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | (Z)-3-(3,4-dimethoxyphenyl)-3-(4-methoxyphenyl)prop-2-enoic acid |
| SMILES | COc1ccc(/C(=C/C(=O)O)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C18H18O5/c1-21-14-7-4-12(5-8-14)15(11-18(19)20)13-6-9-16(22-2)17(10-13)23-3/h4-11H,1-3H3,(H,19,20)/b15-11- |
| InChIKey | IXSNKXPHVCUVNK-PTNGSMBKSA-N |
| XLogP | 3.23 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|