C16H12Br4O2 — CID 171366397
2,3-dibromo-1-(4-bromo-2-methoxyphenyl)-3-(4-bromophenyl)propan-1-one (PubChem CID 171366397) has the molecular formula C16H12Br4O2 and a molecular weight of 555.89 g/mol. Its IUPAC name is 2,3-dibromo-1-(4-bromo-2-methoxyphenyl)-3-(4-bromophenyl)propan-1-one.
| Compound Name | 2,3-dibromo-1-(4-bromo-2-methoxyphenyl)-3-(4-bromophenyl)propan-1-one |
|---|---|
| PubChem CID | 171366397 |
| Molecular Formula | C16H12Br4O2 |
| Molecular Weight | 555.89 g/mol |
| Exact Mass | 551.76 |
| IUPAC Name | 2,3-dibromo-1-(4-bromo-2-methoxyphenyl)-3-(4-bromophenyl)propan-1-one |
| SMILES | COc1cc(Br)ccc1C(=O)C(Br)C(Br)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H12Br4O2/c1-22-13-8-11(18)6-7-12(13)16(21)15(20)14(19)9-2-4-10(17)5-3-9/h2-8,14-15H,1H3 |
| InChIKey | JOAHVHFFNUKIEP-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.89 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|