C15H19BrO3 — CID 153296169
1-(4-bromo-2-methoxyphenyl)-2-propan-2-ylpentane-1,3-dione (PubChem CID 153296169) has the molecular formula C15H19BrO3 and a molecular weight of 327.22 g/mol. Its IUPAC name is 1-(4-bromo-2-methoxyphenyl)-2-propan-2-ylpentane-1,3-dione.
| Compound Name | 1-(4-bromo-2-methoxyphenyl)-2-propan-2-ylpentane-1,3-dione |
|---|---|
| PubChem CID | 153296169 |
| Molecular Formula | C15H19BrO3 |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 1-(4-bromo-2-methoxyphenyl)-2-propan-2-ylpentane-1,3-dione |
| SMILES | CCC(=O)C(C(=O)c1ccc(Br)cc1OC)C(C)C |
| InChI | InChI=1S/C15H19BrO3/c1-5-12(17)14(9(2)3)15(18)11-7-6-10(16)8-13(11)19-4/h6-9,14H,5H2,1-4H3 |
| InChIKey | DBSBRSVSBIPSQX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|