C24H22Br2O4 — CID 102239440
2,3-dibromo-3-(4-methoxyphenyl)-1-(4-methoxy-2-phenylmethoxyphenyl)propan-1-one (PubChem CID 102239440) has the molecular formula C24H22Br2O4 and a molecular weight of 534.24 g/mol. Its IUPAC name is 2,3-dibromo-3-(4-methoxyphenyl)-1-(4-methoxy-2-phenylmethoxyphenyl)propan-1-one.
| Compound Name | 2,3-dibromo-3-(4-methoxyphenyl)-1-(4-methoxy-2-phenylmethoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 102239440 |
| Molecular Formula | C24H22Br2O4 |
| Molecular Weight | 534.24 g/mol |
| Exact Mass | 531.99 |
| IUPAC Name | 2,3-dibromo-3-(4-methoxyphenyl)-1-(4-methoxy-2-phenylmethoxyphenyl)propan-1-one |
| SMILES | COc1ccc(C(Br)C(Br)C(=O)c2ccc(OC)cc2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H22Br2O4/c1-28-18-10-8-17(9-11-18)22(25)23(26)24(27)20-13-12-19(29-2)14-21(20)30-15-16-6-4-3-5-7-16/h3-14,22-23H,15H2,1-2H3 |
| InChIKey | LSSGJEMLYHPATJ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.24 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|