C33H34O8 — CID 134937782
2-(4-hydroxy-5-methoxy-2-phenylmethoxyphenyl)-3,3-dimethoxy-1-(4-methoxy-2-phenylmethoxyphenyl)propan-1-one (PubChem CID 134937782) has the molecular formula C33H34O8 and a molecular weight of 558.63 g/mol. Its IUPAC name is 2-(4-hydroxy-5-methoxy-2-phenylmethoxyphenyl)-3,3-dimethoxy-1-(4-methoxy-2-phenylmethoxyphenyl)propan-1-one.
| Compound Name | 2-(4-hydroxy-5-methoxy-2-phenylmethoxyphenyl)-3,3-dimethoxy-1-(4-methoxy-2-phenylmethoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 134937782 |
| Molecular Formula | C33H34O8 |
| Molecular Weight | 558.63 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | 2-(4-hydroxy-5-methoxy-2-phenylmethoxyphenyl)-3,3-dimethoxy-1-(4-methoxy-2-phenylmethoxyphenyl)propan-1-one |
| SMILES | COc1ccc(C(=O)C(c2cc(OC)c(O)cc2OCc2ccccc2)C(OC)OC)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C33H34O8/c1-36-24-15-16-25(28(17-24)40-20-22-11-7-5-8-12-22)32(35)31(33(38-3)39-4)26-18-30(37-2)27(34)19-29(26)41-21-23-13-9-6-10-14-23/h5-19,31,33-34H,20-21H2,1-4H3 |
| InChIKey | OSCLNVKIUYKCBX-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.63 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|