C35H38O9 — CID 10531674
1-[2,3-dimethoxy-4,6-bis(phenylmethoxy)phenyl]-2-(2,4-dimethoxyphenyl)-3,3-dimethoxypropan-1-one (PubChem CID 10531674) has the molecular formula C35H38O9 and a molecular weight of 602.68 g/mol. Its IUPAC name is 1-[2,3-dimethoxy-4,6-bis(phenylmethoxy)phenyl]-2-(2,4-dimethoxyphenyl)-3,3-dimethoxypropan-1-one.
| Compound Name | 1-[2,3-dimethoxy-4,6-bis(phenylmethoxy)phenyl]-2-(2,4-dimethoxyphenyl)-3,3-dimethoxypropan-1-one |
|---|---|
| PubChem CID | 10531674 |
| Molecular Formula | C35H38O9 |
| Molecular Weight | 602.68 g/mol |
| Exact Mass | 602.25 |
| IUPAC Name | 1-[2,3-dimethoxy-4,6-bis(phenylmethoxy)phenyl]-2-(2,4-dimethoxyphenyl)-3,3-dimethoxypropan-1-one |
| SMILES | COc1ccc(C(C(=O)c2c(OCc3ccccc3)cc(OCc3ccccc3)c(OC)c2OC)C(OC)OC)c(OC)c1 |
| InChI | InChI=1S/C35H38O9/c1-37-25-17-18-26(27(19-25)38-2)30(35(41-5)42-6)32(36)31-28(43-21-23-13-9-7-10-14-23)20-29(33(39-3)34(31)40-4)44-22-24-15-11-8-12-16-24/h7-20,30,35H,21-22H2,1-6H3 |
| InChIKey | KVOQFTMDFRYFQU-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.68 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|