C18H20O5 — CID 139365460
1-(2,3,6-trimethoxy-4-phenylmethoxyphenyl)ethanone (PubChem CID 139365460) has the molecular formula C18H20O5 and a molecular weight of 316.35 g/mol. Its IUPAC name is 1-(2,3,6-trimethoxy-4-phenylmethoxyphenyl)ethanone.
| Compound Name | 1-(2,3,6-trimethoxy-4-phenylmethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 139365460 |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 1-(2,3,6-trimethoxy-4-phenylmethoxyphenyl)ethanone |
| SMILES | COc1cc(OCc2ccccc2)c(OC)c(OC)c1C(C)=O |
| InChI | InChI=1S/C18H20O5/c1-12(19)16-14(20-2)10-15(17(21-3)18(16)22-4)23-11-13-8-6-5-7-9-13/h5-10H,11H2,1-4H3 |
| InChIKey | FSUYBSHDIYZVAM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |