C31H36O13 — CID 135043420
[(3R,6S)-6-(3-acetyl-2,6-dimethoxy-4-phenylmethoxyphenyl)-3,4,5-triacetyloxyoxan-2-yl]methyl acetate (PubChem CID 135043420) has the molecular formula C31H36O13 and a molecular weight of 616.62 g/mol. Its IUPAC name is [(3R,6S)-6-(3-acetyl-2,6-dimethoxy-4-phenylmethoxyphenyl)-3,4,5-triacetyloxyoxan-2-yl]methyl acetate.
| Compound Name | [(3R,6S)-6-(3-acetyl-2,6-dimethoxy-4-phenylmethoxyphenyl)-3,4,5-triacetyloxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 135043420 |
| Molecular Formula | C31H36O13 |
| Molecular Weight | 616.62 g/mol |
| Exact Mass | 616.22 |
| IUPAC Name | [(3R,6S)-6-(3-acetyl-2,6-dimethoxy-4-phenylmethoxyphenyl)-3,4,5-triacetyloxyoxan-2-yl]methyl acetate |
| SMILES | COc1cc(OCc2ccccc2)c(C(C)=O)c(OC)c1[C@@H]1OC(COC(C)=O)[C@@H](OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C31H36O13/c1-16(32)25-23(40-14-21-11-9-8-10-12-21)13-22(37-6)26(28(25)38-7)29-31(43-20(5)36)30(42-19(4)35)27(41-18(3)34)24(44-29)15-39-17(2)33/h8-13,24,27,29-31H,14-15H2,1-7H3/t24?,27-,29+,30?,31?/m1/s1 |
| InChIKey | BLBHANJYFOYFNK-NHBXXIHUSA-N |
| XLogP | 3.28 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.62 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|