C22H27BrO11 — CID 139796412
[(2R,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-(4-bromo-2,5-dimethoxyphenyl)oxan-2-yl]methyl acetate (PubChem CID 139796412) has the molecular formula C22H27BrO11 and a molecular weight of 547.35 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-(4-bromo-2,5-dimethoxyphenyl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-(4-bromo-2,5-dimethoxyphenyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 139796412 |
| Molecular Formula | C22H27BrO11 |
| Molecular Weight | 547.35 g/mol |
| Exact Mass | 546.07 |
| IUPAC Name | [(2R,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-(4-bromo-2,5-dimethoxyphenyl)oxan-2-yl]methyl acetate |
| SMILES | COc1cc([C@@H]2O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)c(OC)cc1Br |
| InChI | InChI=1S/C22H27BrO11/c1-10(24)30-9-18-20(31-11(2)25)22(33-13(4)27)21(32-12(3)26)19(34-18)14-7-17(29-6)15(23)8-16(14)28-5/h7-8,18-22H,9H2,1-6H3/t18-,19+,20+,21+,22+/m1/s1 |
| InChIKey | VZRWYMSBTCDXBA-FXTUREPZSA-N |
| XLogP | 2.26 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|