C25H34O11 — CID 58786117
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-(2,3-diethoxy-5-methylphenyl)oxan-2-yl]methyl acetate (PubChem CID 58786117) has the molecular formula C25H34O11 and a molecular weight of 510.54 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-(2,3-diethoxy-5-methylphenyl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-(2,3-diethoxy-5-methylphenyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 58786117 |
| Molecular Formula | C25H34O11 |
| Molecular Weight | 510.54 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-(2,3-diethoxy-5-methylphenyl)oxan-2-yl]methyl acetate |
| SMILES | CCOc1cc(C)cc([C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)c1OCC |
| InChI | InChI=1S/C25H34O11/c1-8-30-19-11-13(3)10-18(21(19)31-9-2)22-24(34-16(6)28)25(35-17(7)29)23(33-15(5)27)20(36-22)12-32-14(4)26/h10-11,20,22-25H,8-9,12H2,1-7H3/t20-,22+,23-,24+,25+/m1/s1 |
| InChIKey | YZWJILRRERYRAT-DLCDSXJVSA-N |
| XLogP | 2.59 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.54 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|