C24H30O11 — CID 45050579
[(5R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl] 2,4,6-trimethylbenzoate (PubChem CID 45050579) has the molecular formula C24H30O11 and a molecular weight of 494.49 g/mol. Its IUPAC name is [(5R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl] 2,4,6-trimethylbenzoate.
| Compound Name | [(5R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl] 2,4,6-trimethylbenzoate |
|---|---|
| PubChem CID | 45050579 |
| Molecular Formula | C24H30O11 |
| Molecular Weight | 494.49 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | [(5R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl] 2,4,6-trimethylbenzoate |
| SMILES | CC(=O)OCC1OC(OC(=O)c2c(C)cc(C)cc2C)C(OC(C)=O)C(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H30O11/c1-11-8-12(2)19(13(3)9-11)23(29)35-24-22(33-17(7)28)21(32-16(6)27)20(31-15(5)26)18(34-24)10-30-14(4)25/h8-9,18,20-22,24H,10H2,1-7H3/t18?,20-,21?,22?,24?/m1/s1 |
| InChIKey | VXVBBGGBDYMQJH-LNBHEVQJSA-N |
| XLogP | 1.85 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.49 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|