C34H36O12 — CID 58786103
methyl 2-[[4-methoxy-3-[(2S,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]phenyl]methyl]azulene-1-carboxylate (PubChem CID 58786103) has the molecular formula C34H36O12 and a molecular weight of 636.65 g/mol. Its IUPAC name is methyl 2-[[4-methoxy-3-[(2S,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]phenyl]methyl]azulene-1-carboxylate.
| Compound Name | methyl 2-[[4-methoxy-3-[(2S,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]phenyl]methyl]azulene-1-carboxylate |
|---|---|
| PubChem CID | 58786103 |
| Molecular Formula | C34H36O12 |
| Molecular Weight | 636.65 g/mol |
| Exact Mass | 636.22 |
| IUPAC Name | methyl 2-[[4-methoxy-3-[(2S,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]phenyl]methyl]azulene-1-carboxylate |
| SMILES | COC(=O)c1c(Cc2ccc(OC)c([C@@H]3O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]3OC(C)=O)c2)cc2cccccc1-2 |
| InChI | InChI=1S/C34H36O12/c1-18(35)42-17-28-31(43-19(2)36)33(45-21(4)38)32(44-20(3)37)30(46-28)26-15-22(12-13-27(26)40-5)14-24-16-23-10-8-7-9-11-25(23)29(24)34(39)41-6/h7-13,15-16,28,30-33H,14,17H2,1-6H3/t28-,30+,31-,32+,33+/m1/s1 |
| InChIKey | VGIKNHKFKOGTLD-AGLXMARUSA-N |
| XLogP | 3.98 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.65 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|