C40H39NO11 — CID 143676106
[(3R,6S)-3,4,5-triacetyloxy-6-[4-[4-[(4-hydroxyphenyl)iminomethyl]-3-phenylmethoxyphenyl]phenyl]oxan-2-yl]methyl acetate (PubChem CID 143676106) has the molecular formula C40H39NO11 and a molecular weight of 709.75 g/mol. Its IUPAC name is [(3R,6S)-3,4,5-triacetyloxy-6-[4-[4-[(4-hydroxyphenyl)iminomethyl]-3-phenylmethoxyphenyl]phenyl]oxan-2-yl]methyl acetate.
| Compound Name | [(3R,6S)-3,4,5-triacetyloxy-6-[4-[4-[(4-hydroxyphenyl)iminomethyl]-3-phenylmethoxyphenyl]phenyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 143676106 |
| Molecular Formula | C40H39NO11 |
| Molecular Weight | 709.75 g/mol |
| Exact Mass | 709.25 |
| IUPAC Name | [(3R,6S)-3,4,5-triacetyloxy-6-[4-[4-[(4-hydroxyphenyl)iminomethyl]-3-phenylmethoxyphenyl]phenyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](c2ccc(-c3ccc(/C=N/c4ccc(O)cc4)c(OCc4ccccc4)c3)cc2)C(OC(C)=O)C(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C40H39NO11/c1-24(42)47-23-36-38(49-25(2)43)40(51-27(4)45)39(50-26(3)44)37(52-36)30-12-10-29(11-13-30)31-14-15-32(21-41-33-16-18-34(46)19-17-33)35(20-31)48-22-28-8-6-5-7-9-28/h5-21,36-40,46H,22-23H2,1-4H3/b41-21+/t36?,37-,38+,39?,40?/m0/s1 |
| InChIKey | AIOZCJCBWCNUJZ-OBMYDDONSA-N |
| XLogP | 6.19 |
| TPSA | 156.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.75 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|